C13H23N3OS — CID 79764029
[5-[(3,3,5-trimethylcyclohexyl)oxymethyl]-1,3-thiazol-2-yl]hydrazine (PubChem CID 79764029) has the molecular formula C13H23N3OS and a molecular weight of 269.41 g/mol. Its IUPAC name is [5-[(3,3,5-trimethylcyclohexyl)oxymethyl]-1,3-thiazol-2-yl]hydrazine.
| Compound Name | [5-[(3,3,5-trimethylcyclohexyl)oxymethyl]-1,3-thiazol-2-yl]hydrazine |
|---|---|
| PubChem CID | 79764029 |
| Molecular Formula | C13H23N3OS |
| Molecular Weight | 269.41 g/mol |
| Exact Mass | 269.16 |
| IUPAC Name | [5-[(3,3,5-trimethylcyclohexyl)oxymethyl]-1,3-thiazol-2-yl]hydrazine |
| SMILES | CC1CC(OCc2cnc(NN)s2)CC(C)(C)C1 |
| InChI | InChI=1S/C13H23N3OS/c1-9-4-10(6-13(2,3)5-9)17-8-11-7-15-12(16-14)18-11/h7,9-10H,4-6,8,14H2,1-3H3,(H,15,16) |
| InChIKey | YUGXAJBPXYMRHQ-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.41 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|