C11H13ClN2O2S — CID 79764097
1-[(2-chloro-1,3-thiazol-5-yl)methyl]-4,4-dimethylpiperidine-2,6-dione (PubChem CID 79764097) has the molecular formula C11H13ClN2O2S and a molecular weight of 272.76 g/mol. Its IUPAC name is 1-[(2-chloro-1,3-thiazol-5-yl)methyl]-4,4-dimethylpiperidine-2,6-dione.
| Compound Name | 1-[(2-chloro-1,3-thiazol-5-yl)methyl]-4,4-dimethylpiperidine-2,6-dione |
|---|---|
| PubChem CID | 79764097 |
| Molecular Formula | C11H13ClN2O2S |
| Molecular Weight | 272.76 g/mol |
| Exact Mass | 272.04 |
| IUPAC Name | 1-[(2-chloro-1,3-thiazol-5-yl)methyl]-4,4-dimethylpiperidine-2,6-dione |
| SMILES | CC1(C)CC(=O)N(Cc2cnc(Cl)s2)C(=O)C1 |
| InChI | InChI=1S/C11H13ClN2O2S/c1-11(2)3-8(15)14(9(16)4-11)6-7-5-13-10(12)17-7/h5H,3-4,6H2,1-2H3 |
| InChIKey | KWLCBQQBOCRPEI-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.76 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|