C7H5ClF5NOS — CID 79764113
2-chloro-5-(2,2,3,3,3-pentafluoropropoxymethyl)-1,3-thiazole (PubChem CID 79764113) has the molecular formula C7H5ClF5NOS and a molecular weight of 281.63 g/mol. Its IUPAC name is 2-chloro-5-(2,2,3,3,3-pentafluoropropoxymethyl)-1,3-thiazole.
| Compound Name | 2-chloro-5-(2,2,3,3,3-pentafluoropropoxymethyl)-1,3-thiazole |
|---|---|
| PubChem CID | 79764113 |
| Molecular Formula | C7H5ClF5NOS |
| Molecular Weight | 281.63 g/mol |
| Exact Mass | 280.97 |
| IUPAC Name | 2-chloro-5-(2,2,3,3,3-pentafluoropropoxymethyl)-1,3-thiazole |
| SMILES | FC(F)(F)C(F)(F)COCc1cnc(Cl)s1 |
| InChI | InChI=1S/C7H5ClF5NOS/c8-5-14-1-4(16-5)2-15-3-6(9,10)7(11,12)13/h1H,2-3H2 |
| InChIKey | CGYQUCRFCYEBAE-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.63 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|