About N-[(2-hydrazinyl-1,3-thiazol-5-yl)methyl]-N,3-dimethylaniline
N-[(2-hydrazinyl-1,3-thiazol-5-yl)methyl]-N,3-dimethylaniline (PubChem CID 79764122) has the molecular formula C12H16N4S
and a molecular weight of 248.36 g/mol. Its IUPAC name is N-[(2-hydrazinyl-1,3-thiazol-5-yl)methyl]-N,3-dimethylaniline.
Molecular Properties
| Compound Name | N-[(2-hydrazinyl-1,3-thiazol-5-yl)methyl]-N,3-dimethylaniline |
| PubChem CID | 79764122 |
| Molecular Formula | C12H16N4S |
| Molecular Weight | 248.36 g/mol |
| Exact Mass | 248.11 |
| IUPAC Name | N-[(2-hydrazinyl-1,3-thiazol-5-yl)methyl]-N,3-dimethylaniline |
| SMILES | Cc1cccc(N(C)Cc2cnc(NN)s2)c1 |
| InChI | InChI=1S/C12H16N4S/c1-9-4-3-5-10(6-9)16(2)8-11-7-14-12(15-13)17-11/h3-7H,8,13H2,1-2H3,(H,14,15) |
| InChIKey | KFRUKGSBAVHBTI-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 54.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.36 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-[(2-hydrazinyl-1,3-thiazol-5-yl)methyl]-N,3-dimethylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(2-hydrazinyl-1,3-thiazol-5-yl)methyl]-N,3-dimethylaniline?
The IUPAC name of N-[(2-hydrazinyl-1,3-thiazol-5-yl)methyl]-N,3-dimethylaniline (CID 79764122) is N-[(2-hydrazinyl-1,3-thiazol-5-yl)methyl]-N,3-dimethylaniline.
What is the SMILES notation for N-[(2-hydrazinyl-1,3-thiazol-5-yl)methyl]-N,3-dimethylaniline?
The canonical SMILES for N-[(2-hydrazinyl-1,3-thiazol-5-yl)methyl]-N,3-dimethylaniline is Cc1cccc(N(C)Cc2cnc(NN)s2)c1.
What is the InChIKey of N-[(2-hydrazinyl-1,3-thiazol-5-yl)methyl]-N,3-dimethylaniline?
The InChIKey is KFRUKGSBAVHBTI-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16N4S/c1-9-4-3-5-10(6-9)16(2)8-11-7-14-12(15-13)17-11/h3-7H,8,13H2,1-2H3,(H,14,15).
What are the key properties of N-[(2-hydrazinyl-1,3-thiazol-5-yl)methyl]-N,3-dimethylaniline?
N-[(2-hydrazinyl-1,3-thiazol-5-yl)methyl]-N,3-dimethylaniline has a molecular weight of 248.36 g/mol, XLogP of 2.37, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(2-hydrazinyl-1,3-thiazol-5-yl)methyl]-N,3-dimethylaniline is sourced from PubChem (CID 79764122), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).