About 3-[(2-hydrazinyl-1,3-thiazol-5-yl)methyl]-4-methyl-1,3-thiazol-2-one
3-[(2-hydrazinyl-1,3-thiazol-5-yl)methyl]-4-methyl-1,3-thiazol-2-one (PubChem CID 79764145) has the molecular formula C8H10N4OS2
and a molecular weight of 242.33 g/mol. Its IUPAC name is 3-[(2-hydrazinyl-1,3-thiazol-5-yl)methyl]-4-methyl-1,3-thiazol-2-one.
Molecular Properties
| Compound Name | 3-[(2-hydrazinyl-1,3-thiazol-5-yl)methyl]-4-methyl-1,3-thiazol-2-one |
| PubChem CID | 79764145 |
| Molecular Formula | C8H10N4OS2 |
| Molecular Weight | 242.33 g/mol |
| Exact Mass | 242.03 |
| IUPAC Name | 3-[(2-hydrazinyl-1,3-thiazol-5-yl)methyl]-4-methyl-1,3-thiazol-2-one |
| SMILES | Cc1csc(=O)n1Cc1cnc(NN)s1 |
| InChI | InChI=1S/C8H10N4OS2/c1-5-4-14-8(13)12(5)3-6-2-10-7(11-9)15-6/h2,4H,3,9H2,1H3,(H,10,11) |
| InChIKey | QOIISEXVCQFBPC-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 72.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.33 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-[(2-hydrazinyl-1,3-thiazol-5-yl)methyl]-4-methyl-1,3-thiazol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(2-hydrazinyl-1,3-thiazol-5-yl)methyl]-4-methyl-1,3-thiazol-2-one?
The IUPAC name of 3-[(2-hydrazinyl-1,3-thiazol-5-yl)methyl]-4-methyl-1,3-thiazol-2-one (CID 79764145) is 3-[(2-hydrazinyl-1,3-thiazol-5-yl)methyl]-4-methyl-1,3-thiazol-2-one.
What is the SMILES notation for 3-[(2-hydrazinyl-1,3-thiazol-5-yl)methyl]-4-methyl-1,3-thiazol-2-one?
The canonical SMILES for 3-[(2-hydrazinyl-1,3-thiazol-5-yl)methyl]-4-methyl-1,3-thiazol-2-one is Cc1csc(=O)n1Cc1cnc(NN)s1.
What is the InChIKey of 3-[(2-hydrazinyl-1,3-thiazol-5-yl)methyl]-4-methyl-1,3-thiazol-2-one?
The InChIKey is QOIISEXVCQFBPC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N4OS2/c1-5-4-14-8(13)12(5)3-6-2-10-7(11-9)15-6/h2,4H,3,9H2,1H3,(H,10,11).
What are the key properties of 3-[(2-hydrazinyl-1,3-thiazol-5-yl)methyl]-4-methyl-1,3-thiazol-2-one?
3-[(2-hydrazinyl-1,3-thiazol-5-yl)methyl]-4-methyl-1,3-thiazol-2-one has a molecular weight of 242.33 g/mol, XLogP of 1.01, 3 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(2-hydrazinyl-1,3-thiazol-5-yl)methyl]-4-methyl-1,3-thiazol-2-one is sourced from PubChem (CID 79764145), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).