About [5-[(2-ethylcyclohexyl)oxymethyl]-1,3-thiazol-2-yl]hydrazine
[5-[(2-ethylcyclohexyl)oxymethyl]-1,3-thiazol-2-yl]hydrazine (PubChem CID 79764162) has the molecular formula C12H21N3OS
and a molecular weight of 255.39 g/mol. Its IUPAC name is [5-[(2-ethylcyclohexyl)oxymethyl]-1,3-thiazol-2-yl]hydrazine.
Molecular Properties
| Compound Name | [5-[(2-ethylcyclohexyl)oxymethyl]-1,3-thiazol-2-yl]hydrazine |
| PubChem CID | 79764162 |
| Molecular Formula | C12H21N3OS |
| Molecular Weight | 255.39 g/mol |
| Exact Mass | 255.14 |
| IUPAC Name | [5-[(2-ethylcyclohexyl)oxymethyl]-1,3-thiazol-2-yl]hydrazine |
| SMILES | CCC1CCCCC1OCc1cnc(NN)s1 |
| InChI | InChI=1S/C12H21N3OS/c1-2-9-5-3-4-6-11(9)16-8-10-7-14-12(15-13)17-10/h7,9,11H,2-6,8,13H2,1H3,(H,14,15) |
| InChIKey | IHGDCPLVYYRRHB-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.39 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [5-[(2-ethylcyclohexyl)oxymethyl]-1,3-thiazol-2-yl]hydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-[(2-ethylcyclohexyl)oxymethyl]-1,3-thiazol-2-yl]hydrazine?
The IUPAC name of [5-[(2-ethylcyclohexyl)oxymethyl]-1,3-thiazol-2-yl]hydrazine (CID 79764162) is [5-[(2-ethylcyclohexyl)oxymethyl]-1,3-thiazol-2-yl]hydrazine.
What is the SMILES notation for [5-[(2-ethylcyclohexyl)oxymethyl]-1,3-thiazol-2-yl]hydrazine?
The canonical SMILES for [5-[(2-ethylcyclohexyl)oxymethyl]-1,3-thiazol-2-yl]hydrazine is CCC1CCCCC1OCc1cnc(NN)s1.
What is the InChIKey of [5-[(2-ethylcyclohexyl)oxymethyl]-1,3-thiazol-2-yl]hydrazine?
The InChIKey is IHGDCPLVYYRRHB-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H21N3OS/c1-2-9-5-3-4-6-11(9)16-8-10-7-14-12(15-13)17-10/h7,9,11H,2-6,8,13H2,1H3,(H,14,15).
What are the key properties of [5-[(2-ethylcyclohexyl)oxymethyl]-1,3-thiazol-2-yl]hydrazine?
[5-[(2-ethylcyclohexyl)oxymethyl]-1,3-thiazol-2-yl]hydrazine has a molecular weight of 255.39 g/mol, XLogP of 2.91, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [5-[(2-ethylcyclohexyl)oxymethyl]-1,3-thiazol-2-yl]hydrazine is sourced from PubChem (CID 79764162), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).