About N-[(2-hydrazinyl-1,3-thiazol-5-yl)methyl]-3-methoxy-N-methylpropan-1-amine
N-[(2-hydrazinyl-1,3-thiazol-5-yl)methyl]-3-methoxy-N-methylpropan-1-amine (PubChem CID 79764263) has the molecular formula C9H18N4OS
and a molecular weight of 230.34 g/mol. Its IUPAC name is N-[(2-hydrazinyl-1,3-thiazol-5-yl)methyl]-3-methoxy-N-methylpropan-1-amine.
Molecular Properties
| Compound Name | N-[(2-hydrazinyl-1,3-thiazol-5-yl)methyl]-3-methoxy-N-methylpropan-1-amine |
| PubChem CID | 79764263 |
| Molecular Formula | C9H18N4OS |
| Molecular Weight | 230.34 g/mol |
| Exact Mass | 230.12 |
| IUPAC Name | N-[(2-hydrazinyl-1,3-thiazol-5-yl)methyl]-3-methoxy-N-methylpropan-1-amine |
| SMILES | COCCCN(C)Cc1cnc(NN)s1 |
| InChI | InChI=1S/C9H18N4OS/c1-13(4-3-5-14-2)7-8-6-11-9(12-10)15-8/h6H,3-5,7,10H2,1-2H3,(H,11,12) |
| InChIKey | RKIVLSYRVFTNFB-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 63.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.34 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-[(2-hydrazinyl-1,3-thiazol-5-yl)methyl]-3-methoxy-N-methylpropan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(2-hydrazinyl-1,3-thiazol-5-yl)methyl]-3-methoxy-N-methylpropan-1-amine?
The IUPAC name of N-[(2-hydrazinyl-1,3-thiazol-5-yl)methyl]-3-methoxy-N-methylpropan-1-amine (CID 79764263) is N-[(2-hydrazinyl-1,3-thiazol-5-yl)methyl]-3-methoxy-N-methylpropan-1-amine.
What is the SMILES notation for N-[(2-hydrazinyl-1,3-thiazol-5-yl)methyl]-3-methoxy-N-methylpropan-1-amine?
The canonical SMILES for N-[(2-hydrazinyl-1,3-thiazol-5-yl)methyl]-3-methoxy-N-methylpropan-1-amine is COCCCN(C)Cc1cnc(NN)s1.
What is the InChIKey of N-[(2-hydrazinyl-1,3-thiazol-5-yl)methyl]-3-methoxy-N-methylpropan-1-amine?
The InChIKey is RKIVLSYRVFTNFB-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18N4OS/c1-13(4-3-5-14-2)7-8-6-11-9(12-10)15-8/h6H,3-5,7,10H2,1-2H3,(H,11,12).
What are the key properties of N-[(2-hydrazinyl-1,3-thiazol-5-yl)methyl]-3-methoxy-N-methylpropan-1-amine?
N-[(2-hydrazinyl-1,3-thiazol-5-yl)methyl]-3-methoxy-N-methylpropan-1-amine has a molecular weight of 230.34 g/mol, XLogP of 0.90, 7 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(2-hydrazinyl-1,3-thiazol-5-yl)methyl]-3-methoxy-N-methylpropan-1-amine is sourced from PubChem (CID 79764263), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).