About [5-(hexoxymethyl)-1,3-thiazol-2-yl]hydrazine
[5-(hexoxymethyl)-1,3-thiazol-2-yl]hydrazine (PubChem CID 79764282) has the molecular formula C10H19N3OS
and a molecular weight of 229.35 g/mol. Its IUPAC name is [5-(hexoxymethyl)-1,3-thiazol-2-yl]hydrazine.
Molecular Properties
| Compound Name | [5-(hexoxymethyl)-1,3-thiazol-2-yl]hydrazine |
| PubChem CID | 79764282 |
| Molecular Formula | C10H19N3OS |
| Molecular Weight | 229.35 g/mol |
| Exact Mass | 229.12 |
| IUPAC Name | [5-(hexoxymethyl)-1,3-thiazol-2-yl]hydrazine |
| SMILES | CCCCCCOCc1cnc(NN)s1 |
| InChI | InChI=1S/C10H19N3OS/c1-2-3-4-5-6-14-8-9-7-12-10(13-11)15-9/h7H,2-6,8,11H2,1H3,(H,12,13) |
| InChIKey | HKAKPKGQNXXRTM-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.35 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [5-(hexoxymethyl)-1,3-thiazol-2-yl]hydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-(hexoxymethyl)-1,3-thiazol-2-yl]hydrazine?
The IUPAC name of [5-(hexoxymethyl)-1,3-thiazol-2-yl]hydrazine (CID 79764282) is [5-(hexoxymethyl)-1,3-thiazol-2-yl]hydrazine.
What is the SMILES notation for [5-(hexoxymethyl)-1,3-thiazol-2-yl]hydrazine?
The canonical SMILES for [5-(hexoxymethyl)-1,3-thiazol-2-yl]hydrazine is CCCCCCOCc1cnc(NN)s1.
What is the InChIKey of [5-(hexoxymethyl)-1,3-thiazol-2-yl]hydrazine?
The InChIKey is HKAKPKGQNXXRTM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19N3OS/c1-2-3-4-5-6-14-8-9-7-12-10(13-11)15-9/h7H,2-6,8,11H2,1H3,(H,12,13).
What are the key properties of [5-(hexoxymethyl)-1,3-thiazol-2-yl]hydrazine?
[5-(hexoxymethyl)-1,3-thiazol-2-yl]hydrazine has a molecular weight of 229.35 g/mol, XLogP of 2.53, 8 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [5-(hexoxymethyl)-1,3-thiazol-2-yl]hydrazine is sourced from PubChem (CID 79764282), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).