About [5-[(5-methyl-2-propan-2-ylcyclohexyl)oxymethyl]-1,3-thiazol-2-yl]hydrazine
[5-[(5-methyl-2-propan-2-ylcyclohexyl)oxymethyl]-1,3-thiazol-2-yl]hydrazine (PubChem CID 79764285) has the molecular formula C14H25N3OS
and a molecular weight of 283.44 g/mol. Its IUPAC name is [5-[(5-methyl-2-propan-2-ylcyclohexyl)oxymethyl]-1,3-thiazol-2-yl]hydrazine.
Molecular Properties
| Compound Name | [5-[(5-methyl-2-propan-2-ylcyclohexyl)oxymethyl]-1,3-thiazol-2-yl]hydrazine |
| PubChem CID | 79764285 |
| Molecular Formula | C14H25N3OS |
| Molecular Weight | 283.44 g/mol |
| Exact Mass | 283.17 |
| IUPAC Name | [5-[(5-methyl-2-propan-2-ylcyclohexyl)oxymethyl]-1,3-thiazol-2-yl]hydrazine |
| SMILES | CC1CCC(C(C)C)C(OCc2cnc(NN)s2)C1 |
| InChI | InChI=1S/C14H25N3OS/c1-9(2)12-5-4-10(3)6-13(12)18-8-11-7-16-14(17-15)19-11/h7,9-10,12-13H,4-6,8,15H2,1-3H3,(H,16,17) |
| InChIKey | CLVNXTXGSOWZPB-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.44 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [5-[(5-methyl-2-propan-2-ylcyclohexyl)oxymethyl]-1,3-thiazol-2-yl]hydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-[(5-methyl-2-propan-2-ylcyclohexyl)oxymethyl]-1,3-thiazol-2-yl]hydrazine?
The IUPAC name of [5-[(5-methyl-2-propan-2-ylcyclohexyl)oxymethyl]-1,3-thiazol-2-yl]hydrazine (CID 79764285) is [5-[(5-methyl-2-propan-2-ylcyclohexyl)oxymethyl]-1,3-thiazol-2-yl]hydrazine.
What is the SMILES notation for [5-[(5-methyl-2-propan-2-ylcyclohexyl)oxymethyl]-1,3-thiazol-2-yl]hydrazine?
The canonical SMILES for [5-[(5-methyl-2-propan-2-ylcyclohexyl)oxymethyl]-1,3-thiazol-2-yl]hydrazine is CC1CCC(C(C)C)C(OCc2cnc(NN)s2)C1.
What is the InChIKey of [5-[(5-methyl-2-propan-2-ylcyclohexyl)oxymethyl]-1,3-thiazol-2-yl]hydrazine?
The InChIKey is CLVNXTXGSOWZPB-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H25N3OS/c1-9(2)12-5-4-10(3)6-13(12)18-8-11-7-16-14(17-15)19-11/h7,9-10,12-13H,4-6,8,15H2,1-3H3,(H,16,17).
What are the key properties of [5-[(5-methyl-2-propan-2-ylcyclohexyl)oxymethyl]-1,3-thiazol-2-yl]hydrazine?
[5-[(5-methyl-2-propan-2-ylcyclohexyl)oxymethyl]-1,3-thiazol-2-yl]hydrazine has a molecular weight of 283.44 g/mol, XLogP of 3.41, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [5-[(5-methyl-2-propan-2-ylcyclohexyl)oxymethyl]-1,3-thiazol-2-yl]hydrazine is sourced from PubChem (CID 79764285), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).