C7H10F3N3OS — CID 79764294
[5-(1,1,1-trifluoropropan-2-yloxymethyl)-1,3-thiazol-2-yl]hydrazine (PubChem CID 79764294) has the molecular formula C7H10F3N3OS and a molecular weight of 241.24 g/mol. Its IUPAC name is [5-(1,1,1-trifluoropropan-2-yloxymethyl)-1,3-thiazol-2-yl]hydrazine.
| Compound Name | [5-(1,1,1-trifluoropropan-2-yloxymethyl)-1,3-thiazol-2-yl]hydrazine |
|---|---|
| PubChem CID | 79764294 |
| Molecular Formula | C7H10F3N3OS |
| Molecular Weight | 241.24 g/mol |
| Exact Mass | 241.05 |
| IUPAC Name | [5-(1,1,1-trifluoropropan-2-yloxymethyl)-1,3-thiazol-2-yl]hydrazine |
| SMILES | CC(OCc1cnc(NN)s1)C(F)(F)F |
| InChI | InChI=1S/C7H10F3N3OS/c1-4(7(8,9)10)14-3-5-2-12-6(13-11)15-5/h2,4H,3,11H2,1H3,(H,12,13) |
| InChIKey | SGTXUTJZLALBKY-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.24 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|