C7H8F5N3OS — CID 79764569
[5-(2,2,3,3,3-pentafluoropropoxymethyl)-1,3-thiazol-2-yl]hydrazine (PubChem CID 79764569) has the molecular formula C7H8F5N3OS and a molecular weight of 277.22 g/mol. Its IUPAC name is [5-(2,2,3,3,3-pentafluoropropoxymethyl)-1,3-thiazol-2-yl]hydrazine.
| Compound Name | [5-(2,2,3,3,3-pentafluoropropoxymethyl)-1,3-thiazol-2-yl]hydrazine |
|---|---|
| PubChem CID | 79764569 |
| Molecular Formula | C7H8F5N3OS |
| Molecular Weight | 277.22 g/mol |
| Exact Mass | 277.03 |
| IUPAC Name | [5-(2,2,3,3,3-pentafluoropropoxymethyl)-1,3-thiazol-2-yl]hydrazine |
| SMILES | NNc1ncc(COCC(F)(F)C(F)(F)F)s1 |
| InChI | InChI=1S/C7H8F5N3OS/c8-6(9,7(10,11)12)3-16-2-4-1-14-5(15-13)17-4/h1H,2-3,13H2,(H,14,15) |
| InChIKey | JLPAMGUNMDUXHU-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.22 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|