C7H9N5OS2 — CID 79764681
[5-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanylmethyl]-1,3-thiazol-2-yl]hydrazine (PubChem CID 79764681) has the molecular formula C7H9N5OS2 and a molecular weight of 243.32 g/mol. Its IUPAC name is [5-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanylmethyl]-1,3-thiazol-2-yl]hydrazine.
| Compound Name | [5-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanylmethyl]-1,3-thiazol-2-yl]hydrazine |
|---|---|
| PubChem CID | 79764681 |
| Molecular Formula | C7H9N5OS2 |
| Molecular Weight | 243.32 g/mol |
| Exact Mass | 243.02 |
| IUPAC Name | [5-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanylmethyl]-1,3-thiazol-2-yl]hydrazine |
| SMILES | Cc1nnc(SCc2cnc(NN)s2)o1 |
| InChI | InChI=1S/C7H9N5OS2/c1-4-11-12-7(13-4)14-3-5-2-9-6(10-8)15-5/h2H,3,8H2,1H3,(H,9,10) |
| InChIKey | YAWFFJCPULGDPZ-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 89.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.32 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|