C9H11ClN2O3S2 — CID 79764745
4-[(2-chloro-1,3-thiazol-5-yl)methylsulfanyl]-2-formamidobutanoic acid (PubChem CID 79764745) has the molecular formula C9H11ClN2O3S2 and a molecular weight of 294.79 g/mol. Its IUPAC name is 4-[(2-chloro-1,3-thiazol-5-yl)methylsulfanyl]-2-formamidobutanoic acid.
| Compound Name | 4-[(2-chloro-1,3-thiazol-5-yl)methylsulfanyl]-2-formamidobutanoic acid |
|---|---|
| PubChem CID | 79764745 |
| Molecular Formula | C9H11ClN2O3S2 |
| Molecular Weight | 294.79 g/mol |
| Exact Mass | 293.99 |
| IUPAC Name | 4-[(2-chloro-1,3-thiazol-5-yl)methylsulfanyl]-2-formamidobutanoic acid |
| SMILES | O=CNC(CCSCc1cnc(Cl)s1)C(=O)O |
| InChI | InChI=1S/C9H11ClN2O3S2/c10-9-11-3-6(17-9)4-16-2-1-7(8(14)15)12-5-13/h3,5,7H,1-2,4H2,(H,12,13)(H,14,15) |
| InChIKey | MQKVKVDICURJKU-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.79 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|