About 4-chloro-1-[(2-chloro-1,3-thiazol-5-yl)methyl]indole-2,3-dione
4-chloro-1-[(2-chloro-1,3-thiazol-5-yl)methyl]indole-2,3-dione (PubChem CID 79764849) has the molecular formula C12H6Cl2N2O2S
and a molecular weight of 313.17 g/mol. Its IUPAC name is 4-chloro-1-[(2-chloro-1,3-thiazol-5-yl)methyl]indole-2,3-dione.
Molecular Properties
| Compound Name | 4-chloro-1-[(2-chloro-1,3-thiazol-5-yl)methyl]indole-2,3-dione |
| PubChem CID | 79764849 |
| Molecular Formula | C12H6Cl2N2O2S |
| Molecular Weight | 313.17 g/mol |
| Exact Mass | 311.95 |
| IUPAC Name | 4-chloro-1-[(2-chloro-1,3-thiazol-5-yl)methyl]indole-2,3-dione |
| SMILES | O=C1C(=O)N(Cc2cnc(Cl)s2)c2cccc(Cl)c21 |
| InChI | InChI=1S/C12H6Cl2N2O2S/c13-7-2-1-3-8-9(7)10(17)11(18)16(8)5-6-4-15-12(14)19-6/h1-4H,5H2 |
| InChIKey | TUUMJGXRVTYVJR-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 313.17 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 4-chloro-1-[(2-chloro-1,3-thiazol-5-yl)methyl]indole-2,3-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-1-[(2-chloro-1,3-thiazol-5-yl)methyl]indole-2,3-dione?
The IUPAC name of 4-chloro-1-[(2-chloro-1,3-thiazol-5-yl)methyl]indole-2,3-dione (CID 79764849) is 4-chloro-1-[(2-chloro-1,3-thiazol-5-yl)methyl]indole-2,3-dione.
What is the SMILES notation for 4-chloro-1-[(2-chloro-1,3-thiazol-5-yl)methyl]indole-2,3-dione?
The canonical SMILES for 4-chloro-1-[(2-chloro-1,3-thiazol-5-yl)methyl]indole-2,3-dione is O=C1C(=O)N(Cc2cnc(Cl)s2)c2cccc(Cl)c21.
What is the InChIKey of 4-chloro-1-[(2-chloro-1,3-thiazol-5-yl)methyl]indole-2,3-dione?
The InChIKey is TUUMJGXRVTYVJR-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H6Cl2N2O2S/c13-7-2-1-3-8-9(7)10(17)11(18)16(8)5-6-4-15-12(14)19-6/h1-4H,5H2.
What are the key properties of 4-chloro-1-[(2-chloro-1,3-thiazol-5-yl)methyl]indole-2,3-dione?
4-chloro-1-[(2-chloro-1,3-thiazol-5-yl)methyl]indole-2,3-dione has a molecular weight of 313.17 g/mol, XLogP of 3.18, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-1-[(2-chloro-1,3-thiazol-5-yl)methyl]indole-2,3-dione is sourced from PubChem (CID 79764849), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).