About 1-[(2-chloro-1,3-thiazol-5-yl)methyl]-5-fluoropyrimidine-2,4-dione
1-[(2-chloro-1,3-thiazol-5-yl)methyl]-5-fluoropyrimidine-2,4-dione (PubChem CID 79764852) has the molecular formula C8H5ClFN3O2S
and a molecular weight of 261.67 g/mol. Its IUPAC name is 1-[(2-chloro-1,3-thiazol-5-yl)methyl]-5-fluoropyrimidine-2,4-dione.
Molecular Properties
| Compound Name | 1-[(2-chloro-1,3-thiazol-5-yl)methyl]-5-fluoropyrimidine-2,4-dione |
| PubChem CID | 79764852 |
| Molecular Formula | C8H5ClFN3O2S |
| Molecular Weight | 261.67 g/mol |
| Exact Mass | 260.98 |
| IUPAC Name | 1-[(2-chloro-1,3-thiazol-5-yl)methyl]-5-fluoropyrimidine-2,4-dione |
| SMILES | O=c1[nH]c(=O)n(Cc2cnc(Cl)s2)cc1F |
| InChI | InChI=1S/C8H5ClFN3O2S/c9-7-11-1-4(16-7)2-13-3-5(10)6(14)12-8(13)15/h1,3H,2H2,(H,12,14,15) |
| InChIKey | VELYDBZBOZJWJR-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 67.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.67 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-[(2-chloro-1,3-thiazol-5-yl)methyl]-5-fluoropyrimidine-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(2-chloro-1,3-thiazol-5-yl)methyl]-5-fluoropyrimidine-2,4-dione?
The IUPAC name of 1-[(2-chloro-1,3-thiazol-5-yl)methyl]-5-fluoropyrimidine-2,4-dione (CID 79764852) is 1-[(2-chloro-1,3-thiazol-5-yl)methyl]-5-fluoropyrimidine-2,4-dione.
What is the SMILES notation for 1-[(2-chloro-1,3-thiazol-5-yl)methyl]-5-fluoropyrimidine-2,4-dione?
The canonical SMILES for 1-[(2-chloro-1,3-thiazol-5-yl)methyl]-5-fluoropyrimidine-2,4-dione is O=c1[nH]c(=O)n(Cc2cnc(Cl)s2)cc1F.
What is the InChIKey of 1-[(2-chloro-1,3-thiazol-5-yl)methyl]-5-fluoropyrimidine-2,4-dione?
The InChIKey is VELYDBZBOZJWJR-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H5ClFN3O2S/c9-7-11-1-4(16-7)2-13-3-5(10)6(14)12-8(13)15/h1,3H,2H2,(H,12,14,15).
What are the key properties of 1-[(2-chloro-1,3-thiazol-5-yl)methyl]-5-fluoropyrimidine-2,4-dione?
1-[(2-chloro-1,3-thiazol-5-yl)methyl]-5-fluoropyrimidine-2,4-dione has a molecular weight of 261.67 g/mol, XLogP of 0.83, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(2-chloro-1,3-thiazol-5-yl)methyl]-5-fluoropyrimidine-2,4-dione is sourced from PubChem (CID 79764852), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).