C11H11ClN2O2S — CID 79764853
3-[(2-chloro-1,3-thiazol-5-yl)methyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2,4-dione (PubChem CID 79764853) has the molecular formula C11H11ClN2O2S and a molecular weight of 270.74 g/mol. Its IUPAC name is 3-[(2-chloro-1,3-thiazol-5-yl)methyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2,4-dione.
| Compound Name | 3-[(2-chloro-1,3-thiazol-5-yl)methyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2,4-dione |
|---|---|
| PubChem CID | 79764853 |
| Molecular Formula | C11H11ClN2O2S |
| Molecular Weight | 270.74 g/mol |
| Exact Mass | 270.02 |
| IUPAC Name | 3-[(2-chloro-1,3-thiazol-5-yl)methyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2,4-dione |
| SMILES | CC1(C)C2C(=O)N(Cc3cnc(Cl)s3)C(=O)C21 |
| InChI | InChI=1S/C11H11ClN2O2S/c1-11(2)6-7(11)9(16)14(8(6)15)4-5-3-13-10(12)17-5/h3,6-7H,4H2,1-2H3 |
| InChIKey | LRNWADAWKABHGT-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.74 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|