C14H14F3N3O — CID 79764929
2-(3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl)-6-(trifluoromethyl)pyridine-3-carbonitrile (PubChem CID 79764929) has the molecular formula C14H14F3N3O and a molecular weight of 297.28 g/mol. Its IUPAC name is 2-(3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl)-6-(trifluoromethyl)pyridine-3-carbonitrile.
| Compound Name | 2-(3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl)-6-(trifluoromethyl)pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 79764929 |
| Molecular Formula | C14H14F3N3O |
| Molecular Weight | 297.28 g/mol |
| Exact Mass | 297.11 |
| IUPAC Name | 2-(3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl)-6-(trifluoromethyl)pyridine-3-carbonitrile |
| SMILES | N#Cc1ccc(C(F)(F)F)nc1N1CCOC2CCCC21 |
| InChI | InChI=1S/C14H14F3N3O/c15-14(16,17)12-5-4-9(8-18)13(19-12)20-6-7-21-11-3-1-2-10(11)20/h4-5,10-11H,1-3,6-7H2 |
| InChIKey | DWLRBDCUWJDYAZ-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 49.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.28 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |