C6H7N5S3 — CID 79765188
[5-(1,3,4-thiadiazol-2-ylsulfanylmethyl)-1,3-thiazol-2-yl]hydrazine (PubChem CID 79765188) has the molecular formula C6H7N5S3 and a molecular weight of 245.36 g/mol. Its IUPAC name is [5-(1,3,4-thiadiazol-2-ylsulfanylmethyl)-1,3-thiazol-2-yl]hydrazine.
| Compound Name | [5-(1,3,4-thiadiazol-2-ylsulfanylmethyl)-1,3-thiazol-2-yl]hydrazine |
|---|---|
| PubChem CID | 79765188 |
| Molecular Formula | C6H7N5S3 |
| Molecular Weight | 245.36 g/mol |
| Exact Mass | 244.99 |
| IUPAC Name | [5-(1,3,4-thiadiazol-2-ylsulfanylmethyl)-1,3-thiazol-2-yl]hydrazine |
| SMILES | NNc1ncc(CSc2nncs2)s1 |
| InChI | InChI=1S/C6H7N5S3/c7-10-5-8-1-4(14-5)2-12-6-11-9-3-13-6/h1,3H,2,7H2,(H,8,10) |
| InChIKey | BIWQPSJAHFUQKW-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 76.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.36 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|