C8H13F3N4S — CID 79765284
3,3,3-trifluoro-N-[(2-hydrazinyl-1,3-thiazol-5-yl)methyl]-N-methylpropan-1-amine (PubChem CID 79765284) has the molecular formula C8H13F3N4S and a molecular weight of 254.28 g/mol. Its IUPAC name is 3,3,3-trifluoro-N-[(2-hydrazinyl-1,3-thiazol-5-yl)methyl]-N-methylpropan-1-amine.
| Compound Name | 3,3,3-trifluoro-N-[(2-hydrazinyl-1,3-thiazol-5-yl)methyl]-N-methylpropan-1-amine |
|---|---|
| PubChem CID | 79765284 |
| Molecular Formula | C8H13F3N4S |
| Molecular Weight | 254.28 g/mol |
| Exact Mass | 254.08 |
| IUPAC Name | 3,3,3-trifluoro-N-[(2-hydrazinyl-1,3-thiazol-5-yl)methyl]-N-methylpropan-1-amine |
| SMILES | CN(CCC(F)(F)F)Cc1cnc(NN)s1 |
| InChI | InChI=1S/C8H13F3N4S/c1-15(3-2-8(9,10)11)5-6-4-13-7(14-12)16-6/h4H,2-3,5,12H2,1H3,(H,13,14) |
| InChIKey | KCQATVZTOSBSIM-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 54.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.28 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|