C12H14ClN3O2S — CID 79765365
3-[(2-chloro-1,3-thiazol-5-yl)methyl]-1,3-diazaspiro[4.5]decane-2,4-dione (PubChem CID 79765365) has the molecular formula C12H14ClN3O2S and a molecular weight of 299.78 g/mol. Its IUPAC name is 3-[(2-chloro-1,3-thiazol-5-yl)methyl]-1,3-diazaspiro[4.5]decane-2,4-dione.
| Compound Name | 3-[(2-chloro-1,3-thiazol-5-yl)methyl]-1,3-diazaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 79765365 |
| Molecular Formula | C12H14ClN3O2S |
| Molecular Weight | 299.78 g/mol |
| Exact Mass | 299.05 |
| IUPAC Name | 3-[(2-chloro-1,3-thiazol-5-yl)methyl]-1,3-diazaspiro[4.5]decane-2,4-dione |
| SMILES | O=C1NC2(CCCCC2)C(=O)N1Cc1cnc(Cl)s1 |
| InChI | InChI=1S/C12H14ClN3O2S/c13-10-14-6-8(19-10)7-16-9(17)12(15-11(16)18)4-2-1-3-5-12/h6H,1-5,7H2,(H,15,18) |
| InChIKey | CEOMTKWTXRWPBO-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.78 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|