About 3-[(2-hydrazinyl-1,3-thiazol-5-yl)methyl-propan-2-ylamino]propanenitrile
3-[(2-hydrazinyl-1,3-thiazol-5-yl)methyl-propan-2-ylamino]propanenitrile (PubChem CID 79765401) has the molecular formula C10H17N5S
and a molecular weight of 239.35 g/mol. Its IUPAC name is 3-[(2-hydrazinyl-1,3-thiazol-5-yl)methyl-propan-2-ylamino]propanenitrile.
Molecular Properties
| Compound Name | 3-[(2-hydrazinyl-1,3-thiazol-5-yl)methyl-propan-2-ylamino]propanenitrile |
| PubChem CID | 79765401 |
| Molecular Formula | C10H17N5S |
| Molecular Weight | 239.35 g/mol |
| Exact Mass | 239.12 |
| IUPAC Name | 3-[(2-hydrazinyl-1,3-thiazol-5-yl)methyl-propan-2-ylamino]propanenitrile |
| SMILES | CC(C)N(CCC#N)Cc1cnc(NN)s1 |
| InChI | InChI=1S/C10H17N5S/c1-8(2)15(5-3-4-11)7-9-6-13-10(14-12)16-9/h6,8H,3,5,7,12H2,1-2H3,(H,13,14) |
| InChIKey | XXFCMIVICVABIZ-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 77.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.35 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-[(2-hydrazinyl-1,3-thiazol-5-yl)methyl-propan-2-ylamino]propanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(2-hydrazinyl-1,3-thiazol-5-yl)methyl-propan-2-ylamino]propanenitrile?
The IUPAC name of 3-[(2-hydrazinyl-1,3-thiazol-5-yl)methyl-propan-2-ylamino]propanenitrile (CID 79765401) is 3-[(2-hydrazinyl-1,3-thiazol-5-yl)methyl-propan-2-ylamino]propanenitrile.
What is the SMILES notation for 3-[(2-hydrazinyl-1,3-thiazol-5-yl)methyl-propan-2-ylamino]propanenitrile?
The canonical SMILES for 3-[(2-hydrazinyl-1,3-thiazol-5-yl)methyl-propan-2-ylamino]propanenitrile is CC(C)N(CCC#N)Cc1cnc(NN)s1.
What is the InChIKey of 3-[(2-hydrazinyl-1,3-thiazol-5-yl)methyl-propan-2-ylamino]propanenitrile?
The InChIKey is XXFCMIVICVABIZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17N5S/c1-8(2)15(5-3-4-11)7-9-6-13-10(14-12)16-9/h6,8H,3,5,7,12H2,1-2H3,(H,13,14).
What are the key properties of 3-[(2-hydrazinyl-1,3-thiazol-5-yl)methyl-propan-2-ylamino]propanenitrile?
3-[(2-hydrazinyl-1,3-thiazol-5-yl)methyl-propan-2-ylamino]propanenitrile has a molecular weight of 239.35 g/mol, XLogP of 1.55, 6 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(2-hydrazinyl-1,3-thiazol-5-yl)methyl-propan-2-ylamino]propanenitrile is sourced from PubChem (CID 79765401), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).