C10H16F3N5S — CID 79765409
[5-[[4-(2,2,2-trifluoroethyl)piperazin-1-yl]methyl]-1,3-thiazol-2-yl]hydrazine (PubChem CID 79765409) has the molecular formula C10H16F3N5S and a molecular weight of 295.33 g/mol. Its IUPAC name is [5-[[4-(2,2,2-trifluoroethyl)piperazin-1-yl]methyl]-1,3-thiazol-2-yl]hydrazine.
| Compound Name | [5-[[4-(2,2,2-trifluoroethyl)piperazin-1-yl]methyl]-1,3-thiazol-2-yl]hydrazine |
|---|---|
| PubChem CID | 79765409 |
| Molecular Formula | C10H16F3N5S |
| Molecular Weight | 295.33 g/mol |
| Exact Mass | 295.11 |
| IUPAC Name | [5-[[4-(2,2,2-trifluoroethyl)piperazin-1-yl]methyl]-1,3-thiazol-2-yl]hydrazine |
| SMILES | NNc1ncc(CN2CCN(CC(F)(F)F)CC2)s1 |
| InChI | InChI=1S/C10H16F3N5S/c11-10(12,13)7-18-3-1-17(2-4-18)6-8-5-15-9(16-14)19-8/h5H,1-4,6-7,14H2,(H,15,16) |
| InChIKey | WLYJQHQFKHKTTK-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 57.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.33 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|