C7H10N6S2 — CID 79765455
[5-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanylmethyl]-1,3-thiazol-2-yl]hydrazine (PubChem CID 79765455) has the molecular formula C7H10N6S2 and a molecular weight of 242.33 g/mol. Its IUPAC name is [5-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanylmethyl]-1,3-thiazol-2-yl]hydrazine.
| Compound Name | [5-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanylmethyl]-1,3-thiazol-2-yl]hydrazine |
|---|---|
| PubChem CID | 79765455 |
| Molecular Formula | C7H10N6S2 |
| Molecular Weight | 242.33 g/mol |
| Exact Mass | 242.04 |
| IUPAC Name | [5-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanylmethyl]-1,3-thiazol-2-yl]hydrazine |
| SMILES | Cc1nc(SCc2cnc(NN)s2)n[nH]1 |
| InChI | InChI=1S/C7H10N6S2/c1-4-10-7(13-12-4)14-3-5-2-9-6(11-8)15-5/h2H,3,8H2,1H3,(H,9,11)(H,10,12,13) |
| InChIKey | MDXACQFIQKVEKO-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 92.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.33 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|