About 1-[(2-hydrazinyl-1,3-thiazol-5-yl)methyl]pyrrolidin-2-one
1-[(2-hydrazinyl-1,3-thiazol-5-yl)methyl]pyrrolidin-2-one (PubChem CID 79765687) has the molecular formula C8H12N4OS
and a molecular weight of 212.28 g/mol. Its IUPAC name is 1-[(2-hydrazinyl-1,3-thiazol-5-yl)methyl]pyrrolidin-2-one.
Molecular Properties
| Compound Name | 1-[(2-hydrazinyl-1,3-thiazol-5-yl)methyl]pyrrolidin-2-one |
| PubChem CID | 79765687 |
| Molecular Formula | C8H12N4OS |
| Molecular Weight | 212.28 g/mol |
| Exact Mass | 212.07 |
| IUPAC Name | 1-[(2-hydrazinyl-1,3-thiazol-5-yl)methyl]pyrrolidin-2-one |
| SMILES | NNc1ncc(CN2CCCC2=O)s1 |
| InChI | InChI=1S/C8H12N4OS/c9-11-8-10-4-6(14-8)5-12-3-1-2-7(12)13/h4H,1-3,5,9H2,(H,10,11) |
| InChIKey | QABMDZQMKRSUBD-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 71.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.28 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-[(2-hydrazinyl-1,3-thiazol-5-yl)methyl]pyrrolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(2-hydrazinyl-1,3-thiazol-5-yl)methyl]pyrrolidin-2-one?
The IUPAC name of 1-[(2-hydrazinyl-1,3-thiazol-5-yl)methyl]pyrrolidin-2-one (CID 79765687) is 1-[(2-hydrazinyl-1,3-thiazol-5-yl)methyl]pyrrolidin-2-one.
What is the SMILES notation for 1-[(2-hydrazinyl-1,3-thiazol-5-yl)methyl]pyrrolidin-2-one?
The canonical SMILES for 1-[(2-hydrazinyl-1,3-thiazol-5-yl)methyl]pyrrolidin-2-one is NNc1ncc(CN2CCCC2=O)s1.
What is the InChIKey of 1-[(2-hydrazinyl-1,3-thiazol-5-yl)methyl]pyrrolidin-2-one?
The InChIKey is QABMDZQMKRSUBD-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N4OS/c9-11-8-10-4-6(14-8)5-12-3-1-2-7(12)13/h4H,1-3,5,9H2,(H,10,11).
What are the key properties of 1-[(2-hydrazinyl-1,3-thiazol-5-yl)methyl]pyrrolidin-2-one?
1-[(2-hydrazinyl-1,3-thiazol-5-yl)methyl]pyrrolidin-2-one has a molecular weight of 212.28 g/mol, XLogP of 0.55, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(2-hydrazinyl-1,3-thiazol-5-yl)methyl]pyrrolidin-2-one is sourced from PubChem (CID 79765687), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).