C13H16N4S — CID 79765806
[5-[(2-methyl-2,3-dihydroindol-1-yl)methyl]-1,3-thiazol-2-yl]hydrazine (PubChem CID 79765806) has the molecular formula C13H16N4S and a molecular weight of 260.37 g/mol. Its IUPAC name is [5-[(2-methyl-2,3-dihydroindol-1-yl)methyl]-1,3-thiazol-2-yl]hydrazine.
| Compound Name | [5-[(2-methyl-2,3-dihydroindol-1-yl)methyl]-1,3-thiazol-2-yl]hydrazine |
|---|---|
| PubChem CID | 79765806 |
| Molecular Formula | C13H16N4S |
| Molecular Weight | 260.37 g/mol |
| Exact Mass | 260.11 |
| IUPAC Name | [5-[(2-methyl-2,3-dihydroindol-1-yl)methyl]-1,3-thiazol-2-yl]hydrazine |
| SMILES | CC1Cc2ccccc2N1Cc1cnc(NN)s1 |
| InChI | InChI=1S/C13H16N4S/c1-9-6-10-4-2-3-5-12(10)17(9)8-11-7-15-13(16-14)18-11/h2-5,7,9H,6,8,14H2,1H3,(H,15,16) |
| InChIKey | KBSJZYCEUQDJIK-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 54.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.37 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|