About 4-[(2-hydrazinyl-1,3-thiazol-5-yl)methyl]piperazine-2,6-dione
4-[(2-hydrazinyl-1,3-thiazol-5-yl)methyl]piperazine-2,6-dione (PubChem CID 79765813) has the molecular formula C8H11N5O2S
and a molecular weight of 241.28 g/mol. Its IUPAC name is 4-[(2-hydrazinyl-1,3-thiazol-5-yl)methyl]piperazine-2,6-dione.
Molecular Properties
| Compound Name | 4-[(2-hydrazinyl-1,3-thiazol-5-yl)methyl]piperazine-2,6-dione |
| PubChem CID | 79765813 |
| Molecular Formula | C8H11N5O2S |
| Molecular Weight | 241.28 g/mol |
| Exact Mass | 241.06 |
| IUPAC Name | 4-[(2-hydrazinyl-1,3-thiazol-5-yl)methyl]piperazine-2,6-dione |
| SMILES | NNc1ncc(CN2CC(=O)NC(=O)C2)s1 |
| InChI | InChI=1S/C8H11N5O2S/c9-12-8-10-1-5(16-8)2-13-3-6(14)11-7(15)4-13/h1H,2-4,9H2,(H,10,12)(H,11,14,15) |
| InChIKey | GTXSBPZOHDTPOJ-UHFFFAOYSA-N |
| XLogP | -1.11 |
| TPSA | 100.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.28 |
| LogP ≤ 5 | -1.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 4-[(2-hydrazinyl-1,3-thiazol-5-yl)methyl]piperazine-2,6-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(2-hydrazinyl-1,3-thiazol-5-yl)methyl]piperazine-2,6-dione?
The IUPAC name of 4-[(2-hydrazinyl-1,3-thiazol-5-yl)methyl]piperazine-2,6-dione (CID 79765813) is 4-[(2-hydrazinyl-1,3-thiazol-5-yl)methyl]piperazine-2,6-dione.
What is the SMILES notation for 4-[(2-hydrazinyl-1,3-thiazol-5-yl)methyl]piperazine-2,6-dione?
The canonical SMILES for 4-[(2-hydrazinyl-1,3-thiazol-5-yl)methyl]piperazine-2,6-dione is NNc1ncc(CN2CC(=O)NC(=O)C2)s1.
What is the InChIKey of 4-[(2-hydrazinyl-1,3-thiazol-5-yl)methyl]piperazine-2,6-dione?
The InChIKey is GTXSBPZOHDTPOJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11N5O2S/c9-12-8-10-1-5(16-8)2-13-3-6(14)11-7(15)4-13/h1H,2-4,9H2,(H,10,12)(H,11,14,15).
What are the key properties of 4-[(2-hydrazinyl-1,3-thiazol-5-yl)methyl]piperazine-2,6-dione?
4-[(2-hydrazinyl-1,3-thiazol-5-yl)methyl]piperazine-2,6-dione has a molecular weight of 241.28 g/mol, XLogP of -1.11, 3 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(2-hydrazinyl-1,3-thiazol-5-yl)methyl]piperazine-2,6-dione is sourced from PubChem (CID 79765813), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).