C12H9FINO2 — CID 79766324
1-(4-fluoro-2-iodophenyl)-3,4-dimethylpyrrole-2,5-dione (PubChem CID 79766324) has the molecular formula C12H9FINO2 and a molecular weight of 345.11 g/mol. Its IUPAC name is 1-(4-fluoro-2-iodophenyl)-3,4-dimethylpyrrole-2,5-dione.
| Compound Name | 1-(4-fluoro-2-iodophenyl)-3,4-dimethylpyrrole-2,5-dione |
|---|---|
| PubChem CID | 79766324 |
| Molecular Formula | C12H9FINO2 |
| Molecular Weight | 345.11 g/mol |
| Exact Mass | 344.97 |
| IUPAC Name | 1-(4-fluoro-2-iodophenyl)-3,4-dimethylpyrrole-2,5-dione |
| SMILES | CC1=C(C)C(=O)N(c2ccc(F)cc2I)C1=O |
| InChI | InChI=1S/C12H9FINO2/c1-6-7(2)12(17)15(11(6)16)10-4-3-8(13)5-9(10)14/h3-5H,1-2H3 |
| InChIKey | MRMOFNJTXGJRMG-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.11 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|