C13H8BrF3N2O — CID 79767572
N-(3-amino-4-bromophenyl)-2,4,6-trifluorobenzamide (PubChem CID 79767572) has the molecular formula C13H8BrF3N2O and a molecular weight of 345.12 g/mol. Its IUPAC name is N-(3-amino-4-bromophenyl)-2,4,6-trifluorobenzamide.
| Compound Name | N-(3-amino-4-bromophenyl)-2,4,6-trifluorobenzamide |
|---|---|
| PubChem CID | 79767572 |
| Molecular Formula | C13H8BrF3N2O |
| Molecular Weight | 345.12 g/mol |
| Exact Mass | 343.98 |
| IUPAC Name | N-(3-amino-4-bromophenyl)-2,4,6-trifluorobenzamide |
| SMILES | Nc1cc(NC(=O)c2c(F)cc(F)cc2F)ccc1Br |
| InChI | InChI=1S/C13H8BrF3N2O/c14-8-2-1-7(5-11(8)18)19-13(20)12-9(16)3-6(15)4-10(12)17/h1-5H,18H2,(H,19,20) |
| InChIKey | PCPUKTVDSDSPBO-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.12 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|