C13H11FIN3O — CID 79768786
2,4-diamino-N-(4-fluoro-2-iodophenyl)benzamide (PubChem CID 79768786) has the molecular formula C13H11FIN3O and a molecular weight of 371.15 g/mol. Its IUPAC name is 2,4-diamino-N-(4-fluoro-2-iodophenyl)benzamide.
| Compound Name | 2,4-diamino-N-(4-fluoro-2-iodophenyl)benzamide |
|---|---|
| PubChem CID | 79768786 |
| Molecular Formula | C13H11FIN3O |
| Molecular Weight | 371.15 g/mol |
| Exact Mass | 370.99 |
| IUPAC Name | 2,4-diamino-N-(4-fluoro-2-iodophenyl)benzamide |
| SMILES | Nc1ccc(C(=O)Nc2ccc(F)cc2I)c(N)c1 |
| InChI | InChI=1S/C13H11FIN3O/c14-7-1-4-12(10(15)5-7)18-13(19)9-3-2-8(16)6-11(9)17/h1-6H,16-17H2,(H,18,19) |
| InChIKey | WSZABBWVIPIKCW-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 81.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.15 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|