C14H11F3INO — CID 79769099
1-(2,6-difluorophenyl)-2-(4-fluoro-2-iodoanilino)ethanol (PubChem CID 79769099) has the molecular formula C14H11F3INO and a molecular weight of 393.15 g/mol. Its IUPAC name is 1-(2,6-difluorophenyl)-2-(4-fluoro-2-iodoanilino)ethanol.
| Compound Name | 1-(2,6-difluorophenyl)-2-(4-fluoro-2-iodoanilino)ethanol |
|---|---|
| PubChem CID | 79769099 |
| Molecular Formula | C14H11F3INO |
| Molecular Weight | 393.15 g/mol |
| Exact Mass | 392.98 |
| IUPAC Name | 1-(2,6-difluorophenyl)-2-(4-fluoro-2-iodoanilino)ethanol |
| SMILES | OC(CNc1ccc(F)cc1I)c1c(F)cccc1F |
| InChI | InChI=1S/C14H11F3INO/c15-8-4-5-12(11(18)6-8)19-7-13(20)14-9(16)2-1-3-10(14)17/h1-6,13,19-20H,7H2 |
| InChIKey | GRELTVOVEJZJJL-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.15 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|