About 2-[[2-(ethylamino)-1,3-thiazol-5-yl]methyl-propan-2-ylamino]acetamide
2-[[2-(ethylamino)-1,3-thiazol-5-yl]methyl-propan-2-ylamino]acetamide (PubChem CID 79771464) has the molecular formula C11H20N4OS
and a molecular weight of 256.37 g/mol. Its IUPAC name is 2-[[2-(ethylamino)-1,3-thiazol-5-yl]methyl-propan-2-ylamino]acetamide.
Molecular Properties
| Compound Name | 2-[[2-(ethylamino)-1,3-thiazol-5-yl]methyl-propan-2-ylamino]acetamide |
| PubChem CID | 79771464 |
| Molecular Formula | C11H20N4OS |
| Molecular Weight | 256.37 g/mol |
| Exact Mass | 256.14 |
| IUPAC Name | 2-[[2-(ethylamino)-1,3-thiazol-5-yl]methyl-propan-2-ylamino]acetamide |
| SMILES | CCNc1ncc(CN(CC(N)=O)C(C)C)s1 |
| InChI | InChI=1S/C11H20N4OS/c1-4-13-11-14-5-9(17-11)6-15(8(2)3)7-10(12)16/h5,8H,4,6-7H2,1-3H3,(H2,12,16)(H,13,14) |
| InChIKey | ZFFOYWFOIRTBHV-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 71.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.37 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[[2-(ethylamino)-1,3-thiazol-5-yl]methyl-propan-2-ylamino]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[2-(ethylamino)-1,3-thiazol-5-yl]methyl-propan-2-ylamino]acetamide?
The IUPAC name of 2-[[2-(ethylamino)-1,3-thiazol-5-yl]methyl-propan-2-ylamino]acetamide (CID 79771464) is 2-[[2-(ethylamino)-1,3-thiazol-5-yl]methyl-propan-2-ylamino]acetamide.
What is the SMILES notation for 2-[[2-(ethylamino)-1,3-thiazol-5-yl]methyl-propan-2-ylamino]acetamide?
The canonical SMILES for 2-[[2-(ethylamino)-1,3-thiazol-5-yl]methyl-propan-2-ylamino]acetamide is CCNc1ncc(CN(CC(N)=O)C(C)C)s1.
What is the InChIKey of 2-[[2-(ethylamino)-1,3-thiazol-5-yl]methyl-propan-2-ylamino]acetamide?
The InChIKey is ZFFOYWFOIRTBHV-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20N4OS/c1-4-13-11-14-5-9(17-11)6-15(8(2)3)7-10(12)16/h5,8H,4,6-7H2,1-3H3,(H2,12,16)(H,13,14).
What are the key properties of 2-[[2-(ethylamino)-1,3-thiazol-5-yl]methyl-propan-2-ylamino]acetamide?
2-[[2-(ethylamino)-1,3-thiazol-5-yl]methyl-propan-2-ylamino]acetamide has a molecular weight of 256.37 g/mol, XLogP of 1.27, 7 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[2-(ethylamino)-1,3-thiazol-5-yl]methyl-propan-2-ylamino]acetamide is sourced from PubChem (CID 79771464), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).