C11H15N5S — CID 79772011
2-[cyanomethyl-[[2-(propylamino)-1,3-thiazol-5-yl]methyl]amino]acetonitrile (PubChem CID 79772011) has the molecular formula C11H15N5S and a molecular weight of 249.34 g/mol. Its IUPAC name is 2-[cyanomethyl-[[2-(propylamino)-1,3-thiazol-5-yl]methyl]amino]acetonitrile.
| Compound Name | 2-[cyanomethyl-[[2-(propylamino)-1,3-thiazol-5-yl]methyl]amino]acetonitrile |
|---|---|
| PubChem CID | 79772011 |
| Molecular Formula | C11H15N5S |
| Molecular Weight | 249.34 g/mol |
| Exact Mass | 249.10 |
| IUPAC Name | 2-[cyanomethyl-[[2-(propylamino)-1,3-thiazol-5-yl]methyl]amino]acetonitrile |
| SMILES | CCCNc1ncc(CN(CC#N)CC#N)s1 |
| InChI | InChI=1S/C11H15N5S/c1-2-5-14-11-15-8-10(17-11)9-16(6-3-12)7-4-13/h8H,2,5-7,9H2,1H3,(H,14,15) |
| InChIKey | OQRZMWUHZQDTSK-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 75.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.34 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|