C10H7FIN3O3S — CID 79772080
2-[[4-(4-fluoro-2-iodophenyl)-5-oxo-1H-1,2,4-triazol-3-yl]sulfanyl]acetic acid (PubChem CID 79772080) has the molecular formula C10H7FIN3O3S and a molecular weight of 395.15 g/mol. Its IUPAC name is 2-[[4-(4-fluoro-2-iodophenyl)-5-oxo-1H-1,2,4-triazol-3-yl]sulfanyl]acetic acid.
| Compound Name | 2-[[4-(4-fluoro-2-iodophenyl)-5-oxo-1H-1,2,4-triazol-3-yl]sulfanyl]acetic acid |
|---|---|
| PubChem CID | 79772080 |
| Molecular Formula | C10H7FIN3O3S |
| Molecular Weight | 395.15 g/mol |
| Exact Mass | 394.92 |
| IUPAC Name | 2-[[4-(4-fluoro-2-iodophenyl)-5-oxo-1H-1,2,4-triazol-3-yl]sulfanyl]acetic acid |
| SMILES | O=C(O)CSc1n[nH]c(=O)n1-c1ccc(F)cc1I |
| InChI | InChI=1S/C10H7FIN3O3S/c11-5-1-2-7(6(12)3-5)15-9(18)13-14-10(15)19-4-8(16)17/h1-3H,4H2,(H,13,18)(H,16,17) |
| InChIKey | PPFSQKKUDXYBIB-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 87.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.15 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|