About 5-[[cyclopropyl(propyl)amino]methyl]-1,3-thiazol-2-amine
5-[[cyclopropyl(propyl)amino]methyl]-1,3-thiazol-2-amine (PubChem CID 79772205) has the molecular formula C10H17N3S
and a molecular weight of 211.33 g/mol. Its IUPAC name is 5-[[cyclopropyl(propyl)amino]methyl]-1,3-thiazol-2-amine.
Molecular Properties
| Compound Name | 5-[[cyclopropyl(propyl)amino]methyl]-1,3-thiazol-2-amine |
| PubChem CID | 79772205 |
| Molecular Formula | C10H17N3S |
| Molecular Weight | 211.33 g/mol |
| Exact Mass | 211.11 |
| IUPAC Name | 5-[[cyclopropyl(propyl)amino]methyl]-1,3-thiazol-2-amine |
| SMILES | CCCN(Cc1cnc(N)s1)C1CC1 |
| InChI | InChI=1S/C10H17N3S/c1-2-5-13(8-3-4-8)7-9-6-12-10(11)14-9/h6,8H,2-5,7H2,1H3,(H2,11,12) |
| InChIKey | NRKVHTNAFLAYFQ-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.33 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-[[cyclopropyl(propyl)amino]methyl]-1,3-thiazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[[cyclopropyl(propyl)amino]methyl]-1,3-thiazol-2-amine?
The IUPAC name of 5-[[cyclopropyl(propyl)amino]methyl]-1,3-thiazol-2-amine (CID 79772205) is 5-[[cyclopropyl(propyl)amino]methyl]-1,3-thiazol-2-amine.
What is the SMILES notation for 5-[[cyclopropyl(propyl)amino]methyl]-1,3-thiazol-2-amine?
The canonical SMILES for 5-[[cyclopropyl(propyl)amino]methyl]-1,3-thiazol-2-amine is CCCN(Cc1cnc(N)s1)C1CC1.
What is the InChIKey of 5-[[cyclopropyl(propyl)amino]methyl]-1,3-thiazol-2-amine?
The InChIKey is NRKVHTNAFLAYFQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17N3S/c1-2-5-13(8-3-4-8)7-9-6-12-10(11)14-9/h6,8H,2-5,7H2,1H3,(H2,11,12).
What are the key properties of 5-[[cyclopropyl(propyl)amino]methyl]-1,3-thiazol-2-amine?
5-[[cyclopropyl(propyl)amino]methyl]-1,3-thiazol-2-amine has a molecular weight of 211.33 g/mol, XLogP of 2.10, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[[cyclopropyl(propyl)amino]methyl]-1,3-thiazol-2-amine is sourced from PubChem (CID 79772205), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).