About 4-[(2-amino-1,3-thiazol-5-yl)methyl]-1,3-dihydroquinoxalin-2-one
4-[(2-amino-1,3-thiazol-5-yl)methyl]-1,3-dihydroquinoxalin-2-one (PubChem CID 79772293) has the molecular formula C12H12N4OS
and a molecular weight of 260.32 g/mol. Its IUPAC name is 4-[(2-amino-1,3-thiazol-5-yl)methyl]-1,3-dihydroquinoxalin-2-one.
Molecular Properties
| Compound Name | 4-[(2-amino-1,3-thiazol-5-yl)methyl]-1,3-dihydroquinoxalin-2-one |
| PubChem CID | 79772293 |
| Molecular Formula | C12H12N4OS |
| Molecular Weight | 260.32 g/mol |
| Exact Mass | 260.07 |
| IUPAC Name | 4-[(2-amino-1,3-thiazol-5-yl)methyl]-1,3-dihydroquinoxalin-2-one |
| SMILES | Nc1ncc(CN2CC(=O)Nc3ccccc32)s1 |
| InChI | InChI=1S/C12H12N4OS/c13-12-14-5-8(18-12)6-16-7-11(17)15-9-3-1-2-4-10(9)16/h1-5H,6-7H2,(H2,13,14)(H,15,17) |
| InChIKey | ISJHMCKHNBBXPB-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 71.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.32 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-[(2-amino-1,3-thiazol-5-yl)methyl]-1,3-dihydroquinoxalin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(2-amino-1,3-thiazol-5-yl)methyl]-1,3-dihydroquinoxalin-2-one?
The IUPAC name of 4-[(2-amino-1,3-thiazol-5-yl)methyl]-1,3-dihydroquinoxalin-2-one (CID 79772293) is 4-[(2-amino-1,3-thiazol-5-yl)methyl]-1,3-dihydroquinoxalin-2-one.
What is the SMILES notation for 4-[(2-amino-1,3-thiazol-5-yl)methyl]-1,3-dihydroquinoxalin-2-one?
The canonical SMILES for 4-[(2-amino-1,3-thiazol-5-yl)methyl]-1,3-dihydroquinoxalin-2-one is Nc1ncc(CN2CC(=O)Nc3ccccc32)s1.
What is the InChIKey of 4-[(2-amino-1,3-thiazol-5-yl)methyl]-1,3-dihydroquinoxalin-2-one?
The InChIKey is ISJHMCKHNBBXPB-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12N4OS/c13-12-14-5-8(18-12)6-16-7-11(17)15-9-3-1-2-4-10(9)16/h1-5H,6-7H2,(H2,13,14)(H,15,17).
What are the key properties of 4-[(2-amino-1,3-thiazol-5-yl)methyl]-1,3-dihydroquinoxalin-2-one?
4-[(2-amino-1,3-thiazol-5-yl)methyl]-1,3-dihydroquinoxalin-2-one has a molecular weight of 260.32 g/mol, XLogP of 1.68, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(2-amino-1,3-thiazol-5-yl)methyl]-1,3-dihydroquinoxalin-2-one is sourced from PubChem (CID 79772293), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).