About 5-[2-[2-(ethylamino)-1,3-thiazol-5-yl]ethyl]-N-methyl-1,3-thiazol-2-amine
5-[2-[2-(ethylamino)-1,3-thiazol-5-yl]ethyl]-N-methyl-1,3-thiazol-2-amine (PubChem CID 79773872) has the molecular formula C11H16N4S2
and a molecular weight of 268.41 g/mol. Its IUPAC name is 5-[2-[2-(ethylamino)-1,3-thiazol-5-yl]ethyl]-N-methyl-1,3-thiazol-2-amine.
Molecular Properties
| Compound Name | 5-[2-[2-(ethylamino)-1,3-thiazol-5-yl]ethyl]-N-methyl-1,3-thiazol-2-amine |
| PubChem CID | 79773872 |
| Molecular Formula | C11H16N4S2 |
| Molecular Weight | 268.41 g/mol |
| Exact Mass | 268.08 |
| IUPAC Name | 5-[2-[2-(ethylamino)-1,3-thiazol-5-yl]ethyl]-N-methyl-1,3-thiazol-2-amine |
| SMILES | CCNc1ncc(CCc2cnc(NC)s2)s1 |
| InChI | InChI=1S/C11H16N4S2/c1-3-13-11-15-7-9(17-11)5-4-8-6-14-10(12-2)16-8/h6-7H,3-5H2,1-2H3,(H,12,14)(H,13,15) |
| InChIKey | GTEVIXPTWVIKAC-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.41 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 5-[2-[2-(ethylamino)-1,3-thiazol-5-yl]ethyl]-N-methyl-1,3-thiazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[2-[2-(ethylamino)-1,3-thiazol-5-yl]ethyl]-N-methyl-1,3-thiazol-2-amine?
The IUPAC name of 5-[2-[2-(ethylamino)-1,3-thiazol-5-yl]ethyl]-N-methyl-1,3-thiazol-2-amine (CID 79773872) is 5-[2-[2-(ethylamino)-1,3-thiazol-5-yl]ethyl]-N-methyl-1,3-thiazol-2-amine.
What is the SMILES notation for 5-[2-[2-(ethylamino)-1,3-thiazol-5-yl]ethyl]-N-methyl-1,3-thiazol-2-amine?
The canonical SMILES for 5-[2-[2-(ethylamino)-1,3-thiazol-5-yl]ethyl]-N-methyl-1,3-thiazol-2-amine is CCNc1ncc(CCc2cnc(NC)s2)s1.
What is the InChIKey of 5-[2-[2-(ethylamino)-1,3-thiazol-5-yl]ethyl]-N-methyl-1,3-thiazol-2-amine?
The InChIKey is GTEVIXPTWVIKAC-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16N4S2/c1-3-13-11-15-7-9(17-11)5-4-8-6-14-10(12-2)16-8/h6-7H,3-5H2,1-2H3,(H,12,14)(H,13,15).
What are the key properties of 5-[2-[2-(ethylamino)-1,3-thiazol-5-yl]ethyl]-N-methyl-1,3-thiazol-2-amine?
5-[2-[2-(ethylamino)-1,3-thiazol-5-yl]ethyl]-N-methyl-1,3-thiazol-2-amine has a molecular weight of 268.41 g/mol, XLogP of 2.86, 6 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[2-[2-(ethylamino)-1,3-thiazol-5-yl]ethyl]-N-methyl-1,3-thiazol-2-amine is sourced from PubChem (CID 79773872), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).