About 1-[(2-amino-1,3-thiazol-5-yl)methyl]-5-fluoropyrimidine-2,4-dione
1-[(2-amino-1,3-thiazol-5-yl)methyl]-5-fluoropyrimidine-2,4-dione (PubChem CID 79774089) has the molecular formula C8H7FN4O2S
and a molecular weight of 242.23 g/mol. Its IUPAC name is 1-[(2-amino-1,3-thiazol-5-yl)methyl]-5-fluoropyrimidine-2,4-dione.
Molecular Properties
| Compound Name | 1-[(2-amino-1,3-thiazol-5-yl)methyl]-5-fluoropyrimidine-2,4-dione |
| PubChem CID | 79774089 |
| Molecular Formula | C8H7FN4O2S |
| Molecular Weight | 242.23 g/mol |
| Exact Mass | 242.03 |
| IUPAC Name | 1-[(2-amino-1,3-thiazol-5-yl)methyl]-5-fluoropyrimidine-2,4-dione |
| SMILES | Nc1ncc(Cn2cc(F)c(=O)[nH]c2=O)s1 |
| InChI | InChI=1S/C8H7FN4O2S/c9-5-3-13(8(15)12-6(5)14)2-4-1-11-7(10)16-4/h1,3H,2H2,(H2,10,11)(H,12,14,15) |
| InChIKey | VFCSRJWOBTUPAW-UHFFFAOYSA-N |
| XLogP | -0.24 |
| TPSA | 93.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.23 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-[(2-amino-1,3-thiazol-5-yl)methyl]-5-fluoropyrimidine-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(2-amino-1,3-thiazol-5-yl)methyl]-5-fluoropyrimidine-2,4-dione?
The IUPAC name of 1-[(2-amino-1,3-thiazol-5-yl)methyl]-5-fluoropyrimidine-2,4-dione (CID 79774089) is 1-[(2-amino-1,3-thiazol-5-yl)methyl]-5-fluoropyrimidine-2,4-dione.
What is the SMILES notation for 1-[(2-amino-1,3-thiazol-5-yl)methyl]-5-fluoropyrimidine-2,4-dione?
The canonical SMILES for 1-[(2-amino-1,3-thiazol-5-yl)methyl]-5-fluoropyrimidine-2,4-dione is Nc1ncc(Cn2cc(F)c(=O)[nH]c2=O)s1.
What is the InChIKey of 1-[(2-amino-1,3-thiazol-5-yl)methyl]-5-fluoropyrimidine-2,4-dione?
The InChIKey is VFCSRJWOBTUPAW-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7FN4O2S/c9-5-3-13(8(15)12-6(5)14)2-4-1-11-7(10)16-4/h1,3H,2H2,(H2,10,11)(H,12,14,15).
What are the key properties of 1-[(2-amino-1,3-thiazol-5-yl)methyl]-5-fluoropyrimidine-2,4-dione?
1-[(2-amino-1,3-thiazol-5-yl)methyl]-5-fluoropyrimidine-2,4-dione has a molecular weight of 242.23 g/mol, XLogP of -0.24, 2 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(2-amino-1,3-thiazol-5-yl)methyl]-5-fluoropyrimidine-2,4-dione is sourced from PubChem (CID 79774089), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).