About 1-[[2-(propylamino)-1,3-thiazol-5-yl]methyl]pyrimidin-2-one
1-[[2-(propylamino)-1,3-thiazol-5-yl]methyl]pyrimidin-2-one (PubChem CID 79774257) has the molecular formula C11H14N4OS
and a molecular weight of 250.33 g/mol. Its IUPAC name is 1-[[2-(propylamino)-1,3-thiazol-5-yl]methyl]pyrimidin-2-one.
Molecular Properties
| Compound Name | 1-[[2-(propylamino)-1,3-thiazol-5-yl]methyl]pyrimidin-2-one |
| PubChem CID | 79774257 |
| Molecular Formula | C11H14N4OS |
| Molecular Weight | 250.33 g/mol |
| Exact Mass | 250.09 |
| IUPAC Name | 1-[[2-(propylamino)-1,3-thiazol-5-yl]methyl]pyrimidin-2-one |
| SMILES | CCCNc1ncc(Cn2cccnc2=O)s1 |
| InChI | InChI=1S/C11H14N4OS/c1-2-4-12-10-14-7-9(17-10)8-15-6-3-5-13-11(15)16/h3,5-7H,2,4,8H2,1H3,(H,12,14) |
| InChIKey | WLNJDJHFWLDOEY-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.33 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-[[2-(propylamino)-1,3-thiazol-5-yl]methyl]pyrimidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[[2-(propylamino)-1,3-thiazol-5-yl]methyl]pyrimidin-2-one?
The IUPAC name of 1-[[2-(propylamino)-1,3-thiazol-5-yl]methyl]pyrimidin-2-one (CID 79774257) is 1-[[2-(propylamino)-1,3-thiazol-5-yl]methyl]pyrimidin-2-one.
What is the SMILES notation for 1-[[2-(propylamino)-1,3-thiazol-5-yl]methyl]pyrimidin-2-one?
The canonical SMILES for 1-[[2-(propylamino)-1,3-thiazol-5-yl]methyl]pyrimidin-2-one is CCCNc1ncc(Cn2cccnc2=O)s1.
What is the InChIKey of 1-[[2-(propylamino)-1,3-thiazol-5-yl]methyl]pyrimidin-2-one?
The InChIKey is WLNJDJHFWLDOEY-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14N4OS/c1-2-4-12-10-14-7-9(17-10)8-15-6-3-5-13-11(15)16/h3,5-7H,2,4,8H2,1H3,(H,12,14).
What are the key properties of 1-[[2-(propylamino)-1,3-thiazol-5-yl]methyl]pyrimidin-2-one?
1-[[2-(propylamino)-1,3-thiazol-5-yl]methyl]pyrimidin-2-one has a molecular weight of 250.33 g/mol, XLogP of 1.57, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[[2-(propylamino)-1,3-thiazol-5-yl]methyl]pyrimidin-2-one is sourced from PubChem (CID 79774257), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).