About 1-[(2-amino-1,3-thiazol-5-yl)methyl]-5-nitropyridin-2-one
1-[(2-amino-1,3-thiazol-5-yl)methyl]-5-nitropyridin-2-one (PubChem CID 79774260) has the molecular formula C9H8N4O3S
and a molecular weight of 252.25 g/mol. Its IUPAC name is 1-[(2-amino-1,3-thiazol-5-yl)methyl]-5-nitropyridin-2-one.
Molecular Properties
| Compound Name | 1-[(2-amino-1,3-thiazol-5-yl)methyl]-5-nitropyridin-2-one |
| PubChem CID | 79774260 |
| Molecular Formula | C9H8N4O3S |
| Molecular Weight | 252.25 g/mol |
| Exact Mass | 252.03 |
| IUPAC Name | 1-[(2-amino-1,3-thiazol-5-yl)methyl]-5-nitropyridin-2-one |
| SMILES | Nc1ncc(Cn2cc([N+](=O)[O-])ccc2=O)s1 |
| InChI | InChI=1S/C9H8N4O3S/c10-9-11-3-7(17-9)5-12-4-6(13(15)16)1-2-8(12)14/h1-4H,5H2,(H2,10,11) |
| InChIKey | BMEWBLCDHBKWDG-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 104.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.25 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-[(2-amino-1,3-thiazol-5-yl)methyl]-5-nitropyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(2-amino-1,3-thiazol-5-yl)methyl]-5-nitropyridin-2-one?
The IUPAC name of 1-[(2-amino-1,3-thiazol-5-yl)methyl]-5-nitropyridin-2-one (CID 79774260) is 1-[(2-amino-1,3-thiazol-5-yl)methyl]-5-nitropyridin-2-one.
What is the SMILES notation for 1-[(2-amino-1,3-thiazol-5-yl)methyl]-5-nitropyridin-2-one?
The canonical SMILES for 1-[(2-amino-1,3-thiazol-5-yl)methyl]-5-nitropyridin-2-one is Nc1ncc(Cn2cc([N+](=O)[O-])ccc2=O)s1.
What is the InChIKey of 1-[(2-amino-1,3-thiazol-5-yl)methyl]-5-nitropyridin-2-one?
The InChIKey is BMEWBLCDHBKWDG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8N4O3S/c10-9-11-3-7(17-9)5-12-4-6(13(15)16)1-2-8(12)14/h1-4H,5H2,(H2,10,11).
What are the key properties of 1-[(2-amino-1,3-thiazol-5-yl)methyl]-5-nitropyridin-2-one?
1-[(2-amino-1,3-thiazol-5-yl)methyl]-5-nitropyridin-2-one has a molecular weight of 252.25 g/mol, XLogP of 0.84, 3 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(2-amino-1,3-thiazol-5-yl)methyl]-5-nitropyridin-2-one is sourced from PubChem (CID 79774260), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).