About 4-[2-[2-(methylamino)-1,3-thiazol-5-yl]ethyl]thiadiazol-5-amine
4-[2-[2-(methylamino)-1,3-thiazol-5-yl]ethyl]thiadiazol-5-amine (PubChem CID 79774822) has the molecular formula C8H11N5S2
and a molecular weight of 241.34 g/mol. Its IUPAC name is 4-[2-[2-(methylamino)-1,3-thiazol-5-yl]ethyl]thiadiazol-5-amine.
Molecular Properties
| Compound Name | 4-[2-[2-(methylamino)-1,3-thiazol-5-yl]ethyl]thiadiazol-5-amine |
| PubChem CID | 79774822 |
| Molecular Formula | C8H11N5S2 |
| Molecular Weight | 241.34 g/mol |
| Exact Mass | 241.05 |
| IUPAC Name | 4-[2-[2-(methylamino)-1,3-thiazol-5-yl]ethyl]thiadiazol-5-amine |
| SMILES | CNc1ncc(CCc2nnsc2N)s1 |
| InChI | InChI=1S/C8H11N5S2/c1-10-8-11-4-5(14-8)2-3-6-7(9)15-13-12-6/h4H,2-3,9H2,1H3,(H,10,11) |
| InChIKey | PTPOJJCAFGAHBE-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 76.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.34 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 4-[2-[2-(methylamino)-1,3-thiazol-5-yl]ethyl]thiadiazol-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2-[2-(methylamino)-1,3-thiazol-5-yl]ethyl]thiadiazol-5-amine?
The IUPAC name of 4-[2-[2-(methylamino)-1,3-thiazol-5-yl]ethyl]thiadiazol-5-amine (CID 79774822) is 4-[2-[2-(methylamino)-1,3-thiazol-5-yl]ethyl]thiadiazol-5-amine.
What is the SMILES notation for 4-[2-[2-(methylamino)-1,3-thiazol-5-yl]ethyl]thiadiazol-5-amine?
The canonical SMILES for 4-[2-[2-(methylamino)-1,3-thiazol-5-yl]ethyl]thiadiazol-5-amine is CNc1ncc(CCc2nnsc2N)s1.
What is the InChIKey of 4-[2-[2-(methylamino)-1,3-thiazol-5-yl]ethyl]thiadiazol-5-amine?
The InChIKey is PTPOJJCAFGAHBE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11N5S2/c1-10-8-11-4-5(14-8)2-3-6-7(9)15-13-12-6/h4H,2-3,9H2,1H3,(H,10,11).
What are the key properties of 4-[2-[2-(methylamino)-1,3-thiazol-5-yl]ethyl]thiadiazol-5-amine?
4-[2-[2-(methylamino)-1,3-thiazol-5-yl]ethyl]thiadiazol-5-amine has a molecular weight of 241.34 g/mol, XLogP of 1.40, 4 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2-[2-(methylamino)-1,3-thiazol-5-yl]ethyl]thiadiazol-5-amine is sourced from PubChem (CID 79774822), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).