C7H7F5N2OS — CID 79774978
5-(2,2,3,3,3-pentafluoropropoxymethyl)-1,3-thiazol-2-amine (PubChem CID 79774978) has the molecular formula C7H7F5N2OS and a molecular weight of 262.20 g/mol. Its IUPAC name is 5-(2,2,3,3,3-pentafluoropropoxymethyl)-1,3-thiazol-2-amine.
| Compound Name | 5-(2,2,3,3,3-pentafluoropropoxymethyl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 79774978 |
| Molecular Formula | C7H7F5N2OS |
| Molecular Weight | 262.20 g/mol |
| Exact Mass | 262.02 |
| IUPAC Name | 5-(2,2,3,3,3-pentafluoropropoxymethyl)-1,3-thiazol-2-amine |
| SMILES | Nc1ncc(COCC(F)(F)C(F)(F)F)s1 |
| InChI | InChI=1S/C7H7F5N2OS/c8-6(9,7(10,11)12)3-15-2-4-1-14-5(13)16-4/h1H,2-3H2,(H2,13,14) |
| InChIKey | TZRAVFDQRQGFDX-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.20 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|