C14H18N2O2S — CID 79775065
[2-[[2-(propylamino)-1,3-thiazol-5-yl]methoxy]phenyl]methanol (PubChem CID 79775065) has the molecular formula C14H18N2O2S and a molecular weight of 278.38 g/mol. Its IUPAC name is [2-[[2-(propylamino)-1,3-thiazol-5-yl]methoxy]phenyl]methanol.
| Compound Name | [2-[[2-(propylamino)-1,3-thiazol-5-yl]methoxy]phenyl]methanol |
|---|---|
| PubChem CID | 79775065 |
| Molecular Formula | C14H18N2O2S |
| Molecular Weight | 278.38 g/mol |
| Exact Mass | 278.11 |
| IUPAC Name | [2-[[2-(propylamino)-1,3-thiazol-5-yl]methoxy]phenyl]methanol |
| SMILES | CCCNc1ncc(COc2ccccc2CO)s1 |
| InChI | InChI=1S/C14H18N2O2S/c1-2-7-15-14-16-8-12(19-14)10-18-13-6-4-3-5-11(13)9-17/h3-6,8,17H,2,7,9-10H2,1H3,(H,15,16) |
| InChIKey | AMKWLLSUARFBOY-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 54.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.38 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |