C13H15ClN2S2 — CID 79775087
5-[(3-chlorophenyl)sulfanylmethyl]-N-propyl-1,3-thiazol-2-amine (PubChem CID 79775087) has the molecular formula C13H15ClN2S2 and a molecular weight of 298.86 g/mol. Its IUPAC name is 5-[(3-chlorophenyl)sulfanylmethyl]-N-propyl-1,3-thiazol-2-amine.
| Compound Name | 5-[(3-chlorophenyl)sulfanylmethyl]-N-propyl-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 79775087 |
| Molecular Formula | C13H15ClN2S2 |
| Molecular Weight | 298.86 g/mol |
| Exact Mass | 298.04 |
| IUPAC Name | 5-[(3-chlorophenyl)sulfanylmethyl]-N-propyl-1,3-thiazol-2-amine |
| SMILES | CCCNc1ncc(CSc2cccc(Cl)c2)s1 |
| InChI | InChI=1S/C13H15ClN2S2/c1-2-6-15-13-16-8-12(18-13)9-17-11-5-3-4-10(14)7-11/h3-5,7-8H,2,6,9H2,1H3,(H,15,16) |
| InChIKey | CYYDZVKQINIARX-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.86 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |