C13H14F2N2OS — CID 79775254
5-[(3,4-difluorophenoxy)methyl]-N-propyl-1,3-thiazol-2-amine (PubChem CID 79775254) has the molecular formula C13H14F2N2OS and a molecular weight of 284.33 g/mol. Its IUPAC name is 5-[(3,4-difluorophenoxy)methyl]-N-propyl-1,3-thiazol-2-amine.
| Compound Name | 5-[(3,4-difluorophenoxy)methyl]-N-propyl-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 79775254 |
| Molecular Formula | C13H14F2N2OS |
| Molecular Weight | 284.33 g/mol |
| Exact Mass | 284.08 |
| IUPAC Name | 5-[(3,4-difluorophenoxy)methyl]-N-propyl-1,3-thiazol-2-amine |
| SMILES | CCCNc1ncc(COc2ccc(F)c(F)c2)s1 |
| InChI | InChI=1S/C13H14F2N2OS/c1-2-5-16-13-17-7-10(19-13)8-18-9-3-4-11(14)12(15)6-9/h3-4,6-7H,2,5,8H2,1H3,(H,16,17) |
| InChIKey | LIQBYLOTADNTRY-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.33 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |