C11H16N2O — CID 79775770
1-(5-but-3-enoxy-2-pyridinyl)-N-methylmethanamine (PubChem CID 79775770) has the molecular formula C11H16N2O and a molecular weight of 192.26 g/mol. Its IUPAC name is 1-(5-but-3-enoxy-2-pyridinyl)-N-methylmethanamine.
| Compound Name | 1-(5-but-3-enoxy-2-pyridinyl)-N-methylmethanamine |
|---|---|
| PubChem CID | 79775770 |
| Molecular Formula | C11H16N2O |
| Molecular Weight | 192.26 g/mol |
| Exact Mass | 192.13 |
| IUPAC Name | 1-(5-but-3-enoxy-2-pyridinyl)-N-methylmethanamine |
| SMILES | C=CCCOc1ccc(CNC)nc1 |
| InChI | InChI=1S/C11H16N2O/c1-3-4-7-14-11-6-5-10(8-12-2)13-9-11/h3,5-6,9,12H,1,4,7-8H2,2H3 |
| InChIKey | HFSDVYSMBMORMZ-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.26 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|