C10H16N2O4S — CID 79776991
1-(1,1-dioxothian-4-yl)-5-methyl-1,3-diazinane-2,4-dione (PubChem CID 79776991) has the molecular formula C10H16N2O4S and a molecular weight of 260.31 g/mol. Its IUPAC name is 1-(1,1-dioxothian-4-yl)-5-methyl-1,3-diazinane-2,4-dione.
| Compound Name | 1-(1,1-dioxothian-4-yl)-5-methyl-1,3-diazinane-2,4-dione |
|---|---|
| PubChem CID | 79776991 |
| Molecular Formula | C10H16N2O4S |
| Molecular Weight | 260.31 g/mol |
| Exact Mass | 260.08 |
| IUPAC Name | 1-(1,1-dioxothian-4-yl)-5-methyl-1,3-diazinane-2,4-dione |
| SMILES | CC1CN(C2CCS(=O)(=O)CC2)C(=O)NC1=O |
| InChI | InChI=1S/C10H16N2O4S/c1-7-6-12(10(14)11-9(7)13)8-2-4-17(15,16)5-3-8/h7-8H,2-6H2,1H3,(H,11,13,14) |
| InChIKey | ZNYLYCKSWNVGGO-UHFFFAOYSA-N |
| XLogP | -0.25 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.31 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |