C10H16N2O2 — CID 79777374
1-(2-methylcyclopentyl)-1,3-diazinane-2,4-dione (PubChem CID 79777374) has the molecular formula C10H16N2O2 and a molecular weight of 196.25 g/mol. Its IUPAC name is 1-(2-methylcyclopentyl)-1,3-diazinane-2,4-dione.
| Compound Name | 1-(2-methylcyclopentyl)-1,3-diazinane-2,4-dione |
|---|---|
| PubChem CID | 79777374 |
| Molecular Formula | C10H16N2O2 |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.12 |
| IUPAC Name | 1-(2-methylcyclopentyl)-1,3-diazinane-2,4-dione |
| SMILES | CC1CCCC1N1CCC(=O)NC1=O |
| InChI | InChI=1S/C10H16N2O2/c1-7-3-2-4-8(7)12-6-5-9(13)11-10(12)14/h7-8H,2-6H2,1H3,(H,11,13,14) |
| InChIKey | SGWVUTDJEVPHGE-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |