C11H8Cl2N4O2S — CID 79777663
1-(3,5-dichloro-8λ4-thia-7,9-diazabicyclo[4.3.0]nona-1(6),2,4,7,8-pentaen-2-yl)-5-methyl-1,3-diazinane-2,4-dione (PubChem CID 79777663) has the molecular formula C11H8Cl2N4O2S and a molecular weight of 331.18 g/mol. Its IUPAC name is 1-(3,5-dichloro-8λ4-thia-7,9-diazabicyclo[4.3.0]nona-1(6),2,4,7,8-pentaen-2-yl)-5-methyl-1,3-diazinane-2,4-dione.
| Compound Name | 1-(3,5-dichloro-8λ4-thia-7,9-diazabicyclo[4.3.0]nona-1(6),2,4,7,8-pentaen-2-yl)-5-methyl-1,3-diazinane-2,4-dione |
|---|---|
| PubChem CID | 79777663 |
| Molecular Formula | C11H8Cl2N4O2S |
| Molecular Weight | 331.18 g/mol |
| Exact Mass | 329.97 |
| IUPAC Name | 1-(3,5-dichloro-8λ4-thia-7,9-diazabicyclo[4.3.0]nona-1(6),2,4,7,8-pentaen-2-yl)-5-methyl-1,3-diazinane-2,4-dione |
| SMILES | CC1CN(c2c(Cl)cc(Cl)c3c2N=S=N3)C(=O)NC1=O |
| InChI | InChI=1S/C11H8Cl2N4O2S/c1-4-3-17(11(19)14-10(4)18)9-6(13)2-5(12)7-8(9)16-20-15-7/h2,4H,3H2,1H3,(H,14,18,19) |
| InChIKey | OGRDOBCPDOSAGE-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 74.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.18 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |