About 1-(2,4-difluorophenyl)-2-[(1-methylpyrazol-3-yl)amino]ethanol
1-(2,4-difluorophenyl)-2-[(1-methylpyrazol-3-yl)amino]ethanol (PubChem CID 79778270) has the molecular formula C12H13F2N3O
and a molecular weight of 253.25 g/mol. Its IUPAC name is 1-(2,4-difluorophenyl)-2-[(1-methylpyrazol-3-yl)amino]ethanol.
Molecular Properties
| Compound Name | 1-(2,4-difluorophenyl)-2-[(1-methylpyrazol-3-yl)amino]ethanol |
| PubChem CID | 79778270 |
| Molecular Formula | C12H13F2N3O |
| Molecular Weight | 253.25 g/mol |
| Exact Mass | 253.10 |
| IUPAC Name | 1-(2,4-difluorophenyl)-2-[(1-methylpyrazol-3-yl)amino]ethanol |
| SMILES | Cn1ccc(NCC(O)c2ccc(F)cc2F)n1 |
| InChI | InChI=1S/C12H13F2N3O/c1-17-5-4-12(16-17)15-7-11(18)9-3-2-8(13)6-10(9)14/h2-6,11,18H,7H2,1H3,(H,15,16) |
| InChIKey | QBHMMTPUMPYVJM-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.25 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(2,4-difluorophenyl)-2-[(1-methylpyrazol-3-yl)amino]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2,4-difluorophenyl)-2-[(1-methylpyrazol-3-yl)amino]ethanol?
The IUPAC name of 1-(2,4-difluorophenyl)-2-[(1-methylpyrazol-3-yl)amino]ethanol (CID 79778270) is 1-(2,4-difluorophenyl)-2-[(1-methylpyrazol-3-yl)amino]ethanol.
What is the SMILES notation for 1-(2,4-difluorophenyl)-2-[(1-methylpyrazol-3-yl)amino]ethanol?
The canonical SMILES for 1-(2,4-difluorophenyl)-2-[(1-methylpyrazol-3-yl)amino]ethanol is Cn1ccc(NCC(O)c2ccc(F)cc2F)n1.
What is the InChIKey of 1-(2,4-difluorophenyl)-2-[(1-methylpyrazol-3-yl)amino]ethanol?
The InChIKey is QBHMMTPUMPYVJM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13F2N3O/c1-17-5-4-12(16-17)15-7-11(18)9-3-2-8(13)6-10(9)14/h2-6,11,18H,7H2,1H3,(H,15,16).
What are the key properties of 1-(2,4-difluorophenyl)-2-[(1-methylpyrazol-3-yl)amino]ethanol?
1-(2,4-difluorophenyl)-2-[(1-methylpyrazol-3-yl)amino]ethanol has a molecular weight of 253.25 g/mol, XLogP of 1.84, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2,4-difluorophenyl)-2-[(1-methylpyrazol-3-yl)amino]ethanol is sourced from PubChem (CID 79778270), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).