C10H9F3N4 — CID 79778691
N-(1-methylpyrazol-3-yl)-6-(trifluoromethyl)pyridin-2-amine (PubChem CID 79778691) has the molecular formula C10H9F3N4 and a molecular weight of 242.20 g/mol. Its IUPAC name is N-(1-methylpyrazol-3-yl)-6-(trifluoromethyl)pyridin-2-amine.
| Compound Name | N-(1-methylpyrazol-3-yl)-6-(trifluoromethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 79778691 |
| Molecular Formula | C10H9F3N4 |
| Molecular Weight | 242.20 g/mol |
| Exact Mass | 242.08 |
| IUPAC Name | N-(1-methylpyrazol-3-yl)-6-(trifluoromethyl)pyridin-2-amine |
| SMILES | Cn1ccc(Nc2cccc(C(F)(F)F)n2)n1 |
| InChI | InChI=1S/C10H9F3N4/c1-17-6-5-9(16-17)15-8-4-2-3-7(14-8)10(11,12)13/h2-6H,1H3,(H,14,15,16) |
| InChIKey | YZSWHTWIDZENRF-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.20 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |